LBF20307HO01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03050007 | |LipidMaps=LMFA03050007 | ||
|SysName=15S-hydroxy-8Z,11Z,13E-eicosatrienoic acid | |SysName=15S-hydroxy-8Z,11Z,13E-eicosatrienoic acid | ||
|Common Name=&&15S-hydroxy-8Z,11Z,13E-eicosatrienoic acid&& | |||
|UV Spectra=<FONT FACE="Symbol">l</FONT>max: 235nm <FONT FACE="Symbol">e</FONT>: 23,000 | |UV Spectra=<FONT FACE="Symbol">l</FONT>max: 235nm <FONT FACE="Symbol">e</FONT>: 23,000 | ||
}} | }} | ||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA8144 |
| LipidMaps | LMFA03050007 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20307HO01 |
| 15S-hydroxy-8Z,11Z,13E-eicosatrienoic acid | |
|---|---|
| |
| Structural Information | |
| 15S-hydroxy-8Z,11Z,13E-eicosatrienoic acid | |
| |
| Formula | C20H34O3 |
| Exact Mass | 322.25079495399996 |
| Average Mass | 322.48216 |
| SMILES | C(CCC(C=CC=CCC=CCCCCCCC(O)=O)O)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | lmax: 235nm e: 23,000 |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
