LBF20406AM17: Difference between revisions
No edit summary |
No edit summary |
||
(No difference)
| |||
Revision as of 09:03, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR7033 |
| LipidMaps | LMFA08020019 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20406AM17 |
| N- (1,1-dimethyl-2-hydroxyethyl) arachidonoyl amide | |
|---|---|
| |
| Structural Information | |
| N- (1,1-dimethyl-2-hydroxyethyl) arachidonoyl amide | |
| |
| Formula | C24H41NO2 |
| Exact Mass | 375.313729561 |
| Average Mass | 375.58788 |
| SMILES | C(=CCCCC(=O)NC(CO)(C)C)CC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| colorless oil Sheskin_T et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.50 (br s, 1H), 5.28-5.40 (m,8H), 3.57 (s, 2H), 2.78-2.90 (m, 6H), 2.02-2.20 (m, 6H), 1.62-1.74 (m, 2H), 1.20-1.40 (m, 12H), 0.89 (t, J=7.1Hz, 3H). SheskinTet al. |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
