LBF20406AM20: Difference between revisions
No edit summary |
No edit summary |
||
(No difference)
| |||
Revision as of 09:02, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR7036 |
| LipidMaps | LMFA08020022 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20406AM20 |
| N'-arachidonoyl-N"-diethylethylenediamine | |
|---|---|
| |
| Structural Information | |
| N'-arachidonoyl-N"-diethylethylenediamine | |
| |
| Formula | C26H44N2O |
| Exact Mass | 400.34536404 |
| Average Mass | 400.64043999999996 |
| SMILES | C(CCC)CC=CCC=CCC=CCC=CCCCC(=O)NC=CN(CC)CC |
| Physicochemical Information | |
| colorless oil Sheskin_T et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d6.10 (br s lH), 5.26-5.42 (m, 8H), 3.22-3.30 (m, 2H), 2.76-2.90 (m, 6H), 2.50-2.62 (m, 6H), 1.66-1.80 (m, 2H), 1.20-1.40 (m, 6H), 1.02 (t, J=7.1Hz, 6H), 0.89 (t, J=6.5Hz, 3H). SheskinTet al. |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
