LBF20406AM41: Difference between revisions
m LBF20506AM01 moved to LBF20406AM41 |
m LBF20506AM01 moved to LBF20406AM41 |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA08020052 | |LipidMaps=LMFA08020052 | ||
|SysName=arachidonoylmorpholine | |SysName=arachidonoylmorpholine | ||
|Common Name=&&arachidonoylmorpholine&& | |||
}} | }} | ||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR7066 |
| LipidMaps | LMFA08020052 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20406AM41 |
| arachidonoylmorpholine | |
|---|---|
| |
| Structural Information | |
| arachidonoylmorpholine | |
| |
| Formula | C24H39NO2 |
| Exact Mass | 373.298079497 |
| Average Mass | 373.572 |
| SMILES | O=C(N(C1)CCOC1)CCCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
