LBF22109SC02: Difference between revisions
No edit summary |
No edit summary |
||
| Line 10: | Line 10: | ||
|Density=dX<sub>4</sub><sup>70</sup> 0.85002 | |Density=dX<sub>4</sub><sup>70</sup> 0.85002 | ||
|Optical=1.44349 at 70°C | |Optical=1.44349 at 70°C | ||
|Solubility=sparingly solbule in cold ethanol | |Solubility=sparingly solbule in cold ethanol | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0129 |
| LipidMaps | LMFA01030090 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF22109SC02 |
| trans-Brassidic acid | |
|---|---|
| |
| Structural Information | |
| trans-13-Docosenoic acid | |
| |
| Formula | C22H42O2 |
| Exact Mass | 338.318480588 |
| Average Mass | 338.56768000000005 |
| SMILES | C(CCC(O)=O)CCCCCCCCC=CCCCCCCCC |
| Physicochemical Information | |
| 61.9°C | |
| 265°C at 15 mmHg | |
| dX470 0.85002 | |
| 1.44349 at 70°C | |
| sparingly solbule in cold ethanol | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
