LBF232nnPG03: Difference between revisions
m LBF237nnPG03 moved to LBF232nnPG03 |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03010123 | |LipidMaps=LMFA03010123 | ||
|SysName=9a,11a,15S-trihydroxy-17-phenyl-18,19,20-trinor-5Z,13E-dien-1-amide | |SysName=9a,11a,15S-trihydroxy-17-phenyl-18,19,20-trinor-5Z,13E-dien-1-amide | ||
|Common Name=&&17-phenyl trinor Prostaglandin | |Common Name=&&17-phenyl trinor Prostaglandin F_2alpha amide&& | ||
}} | }} | ||
Revision as of 16:55, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1794 |
| LipidMaps | LMFA03010123 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF232nnPG03 |
| 17-phenyl trinor Prostaglandin F_2α amide | |
|---|---|
| |
| Structural Information | |
| 9a,11a,15S-trihydroxy-17-phenyl-18,19,20-trinor-5Z,13E-dien-1-amide | |
| |
| Formula | C23H33NO4 |
| Exact Mass | 387.24095854899997 |
| Average Mass | 387.51246 |
| SMILES | C(c(c2)cccc2)C[C@@H](C=C[C@H]([C@H]1CC=CCCCC(N)=O)[C@@H](C[C@H](O)1)O)O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
