LBG00-kk::16000BC12:16114BC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 2: | Line 2: | ||
|LipidBank=EEL0139 | |LipidBank=EEL0139 | ||
|SysName=3-O-phytyl-2-O-phytanyl-sn-glycerol | |SysName=3-O-phytyl-2-O-phytanyl-sn-glycerol | ||
|Common Name=&&3-O-phytyl-2-O-phytanyl-sn-glycerol&& | |||
|Chromatograms={{Image200|LBG00-kk::16000BC12:16114BC01:01CH0022.gif}} <<0153>>, | |Chromatograms={{Image200|LBG00-kk::16000BC12:16114BC01:01CH0022.gif}} <<0153>>, | ||
}} | }} | ||
Revision as of 20:00, 8 July 2009
| IDs and Links | |
|---|---|
| LipidBank | EEL0139 |
| LipidMaps | [1] |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBG00-kk::16000BC12:16114BC01 |
| 3-O-phytyl-2-O-phytanyl-sn-glycerol | |
|---|---|
| |
| Structural Information | |
| 3-O-phytyl-2-O-phytanyl-sn-glycerol | |
| |
| Formula | C43H86O3 |
| Exact Mass | 650.657696618 |
| Average Mass | 651.14114 |
| SMILES | C(C(COCC=C(CCCC(CCCC(C)CCCC(C)C)C)C)OCCC(CCCC(CCCC(C)CCCC(C)C)C)C)O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | File:LBG00-kk::16000BC12:16114BC01:01CH0022.gif <<0153>>, |
