| Methyl-13,15-Epidioxy-16-Hydroperoxy-9,11-Octadecadienoate
|
|
| Structural Information
|
|
|
Methyl-13,15-Epidioxy-16-Hydroperoxy-9,11-Octadecadienoate
|
|
|
- Methyl-13,15-Epidioxy-16-Hydroperoxy-9,11-Octadecadienoate
|
|
|
|
| Formula
|
C19H32O6
|
| Exact Mass
|
356.219888756
|
| Average Mass
|
356.45378
|
| SMILES
|
C(O1)(CC(C=CC=CCCCCCCCC(=O)OC)O1)C(CC)OO
|
| Physicochemical Information
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Spectral Information
|
| Mass Spectra
|
GC-EI-MS(after reduction(PH3P) and TMS-derivatization)
Neff_WE et al.: m/e=397[M-CH3], 131[SMTO=CHCH2CH3]; GC-EI-MS(after reduction(NaBH4 or KI) and TMS-derivatization)
Frankel_EN et al.: m/e=311[SMTO=CH-CH=CH-CH=CH-(CH2)7COOCH3]; 131[SMTO=CHCH2CH3]
|
| UV Spectra
|
Conjugated cis, trans diene: lmax=234-237nm, conjugated trans, trans diene: lmax=231-234nm
ToyodaIet al.
Neff_WE et al.
Coxon_DT et al.
Neff_WE et al.
Chan_HWS et al.
|
| IR Spectra
|
OOH group: 3720-3140cm-1[bonded], 3530-3520cm-1[FREE]; olefinic protons: 3020-3000cm-1; conjugated cis, trans diene : 989-980cm-1, 955-947cm-1; conjugatedtrans, trans diene: 992-984cm-1, 955cm-1
ToyodaIet al.
Neff_WE et al.
Coxon_DT et al.
Neff_WE et al.
Neff_WE et al.
Chan_HWS et al.
|
| NMR Spectra
|
1H-NMR
Neff_WE et al.
Coxon_DT et al.
Neff_WE et al.
Chan_HWS et al.: C9: 5.46-5.78; C10: 5.99-6.05; C11: 6.26-6.67; C12: 5.53- 5.62; C13: 4.75-4.84; C14: 2.23-2.47, 2.79-2.88; C15: 4.47-4.49; C16: 3.86-4.15; OOH: 8.98-9.55ppm; J9-15=10.0-11.0[cis]; J9-10=15.1-15.5[trans]; J11-12=14.5-15.4Hz[trans]
|
| Other Spectra
|
|
| Chromatograms
|
|