LBF20207PG66
| IDs and Links | |
|---|---|
| LipidBank | XPR1744 |
| LipidMaps | LMFA03010062 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20207PG66 |
| 11-deoxy-16,16-dimethyl Prostaglandin E2 | |
|---|---|
| |
| Structural Information | |
| 9-Oxo-15R-hydroxy-16,16-dimethyl-prost- (cis-5,trans-13) -dien-1-oic acid | |
| |
| Formula | C22H36O4 |
| Exact Mass | 364.26135963999997 |
| Average Mass | 364.51884 |
| SMILES | C(C(C)(C)[C@H](C=C[C@@H](C1)[C@@H](CC=CCCCC(O)=O)C(C1)=O)O)CCC |
| Physicochemical Information | |
| In rat, 11-deoxy-16,16-dimethyl Prostaglandin E2 inhibits secretion of gastric acid secretion so that suppresses ulcer formation. Lippmann_W 11-deoxy-16,16-dimethyl Prostaglandin E2 contracts human resporatory tract smooth muscle. Karim_SM et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
