LBF20402SC01
| IDs and Links | |
|---|---|
| LipidBank | DFA0214 |
| LipidMaps | LMFA01030175 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20402SC01 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 6, 10, 14, 18-Eicosatetraenoic acid / 6, 10, 14, 18-icosatetraenoic acid | |
| Formula | C20H32O2 |
| Exact Mass | 304.240230268 |
| Average Mass | 304.46688 |
| SMILES | C(CC=CCCC=CCCC=CCCCCC(O)=O)C=CC |
| Physicochemical Information | |
| 0.9263 at 20 °C | |
| 1.4935 at 20 °C | |
| soluble in acetone, methyl alcohol, ether and petroleum ether. James_AT et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
