LBF18108HO03
| IDs and Links | |
|---|---|
| LipidBank | DFA8025 |
| LipidMaps | LMFA01050127 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18108HO03 |
| 9,13-Dihydroxy-10-Octadecenoic Acid/9,13-Dihydroxy-10-Octadecenoate | |
|---|---|
| |
| Structural Information | |
| 9,13-Dihydroxy-10-Octadecenoic Acid/9,13-Dihydroxy-10-Octadecenoate | |
| |
| Formula | C18H34O4 |
| Exact Mass | 314.24570957599997 |
| Average Mass | 314.46016 |
| SMILES | CCCCCC(O)CC=CC(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation) StreckertGet al. Neff_WE et al. TeraoJet al. Frankel_EN et al.: m/e=429[M-43], 355, 285[CH=CH-CH(OTMS) -(CH2)7COOCH3], 259[SMTO=CH-(CH2)7COOCH3], 173[SMTO=CH-(CH2)4CH3], GC-EI-MS(after methanolysis, hydrogenation and trimethylsilylation) StreckertGet al. TeraoJet al. |
| UV Spectra | |
| IR Spectra | Trans unsaturation(980cm-1), olefinic(3010cm-1), OH(3620-3500cm-1) Neff_WE et al. |
| NMR Spectra | 1H-NMR(90MHz,CDCl3): trans olefinic protons(5.6-6.22ppm), carbinol methine protons(4.12ppm), J10-11=12.1Hz(trans unsaturation) Neff_WE et al. |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
