LBF18206SC05
| IDs and Links | |
|---|---|
| LipidBank | DFA0159 |
| LipidMaps | LMFA01030120 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18206SC05 |
| Linoleic acid | |
|---|---|
| |
| Structural Information | |
| cis-9, cis-12-Octadecadienoic acid | |
| |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCC=CCC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| -5°C | |
| 229°C to 230°C at 16mmHg | |
| dX420 0.9031 | |
| 1.4711 at 20°C | |
| soluble in acetone, alcohol, ether and petroleum ether.<<0193>><<0351>><<0378>><<0409>><<0410>> | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | Gas liquid chromatogram (provided by Dr. Akiko Horiuchi). |
| Reported Metabolites, References | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
