LBF18206SC08
| IDs and Links | |
|---|---|
| LipidBank | DFA0162 |
| LipidMaps | LMFA01030123 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18206SC08 |
| Linolelaidic | |
|---|---|
| |
| Structural Information | |
| trans-9, trans-12-Octadecadienoic acid | |
| |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCC=CCC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 28°C to 29°C | |
| 179°C to 183°C at 0.8mmHg | |
| 1.4641 at 27°C | |
| soluble in alcohol, ether, methyl alcohol and petroleum ether.<<0127>><<0193>><<0275>> | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
