LBF18207SC01
IDs and Links | |
---|---|
LipidBank | DFA0155 |
LipidMaps | LMFA01030116 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | {{{KNApSAcK}}} |
mol | LBF18207SC01 |
GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
---|---|
Structural Information | |
cis-8, cis-11-Octadecadienoic acid | |
Formula | C18H32O2 |
Exact Mass | 280.240230268 |
Average Mass | 280.44548000000003 |
SMILES | CCCCCCC=CCC=CCCCCCCC(O)=O |
Physicochemical Information | |
-12.5°C to -9.5°C | |
11.8°C to 20°C at 0.0001mmHg | |
1.4663 at 25°C | |
Fulco_AJ et al. KlenkEet al. | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Other Spectra | |
Chromatograms |
Reported Metabolites, References | |||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|