LBF18306SC02
IDs and Links | |
---|---|
LipidBank | DFA0180 |
LipidMaps | LMFA01030141 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | {{{KNApSAcK}}} |
mol | LBF18306SC02 |
γ-Linolenic acid | |
---|---|
Structural Information | |
cis-6, cis-9, cis-12-Octadecatrienoic acid | |
| |
Formula | C18H30O2 |
Exact Mass | 278.224580204 |
Average Mass | 278.4296 |
SMILES | CCCCCC=CCC=CCC=CCCCCC(O)=O |
Physicochemical Information | |
-11.3 to -11°C | |
125°C at 0.05mmHg | |
dX420 0.9164 | |
1.4800 at 20°C | |
soluble in acetone, ether, methylalcohol and petroleum ether.<<0352>><<0383>><<0415>> | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Other Spectra | |
Chromatograms |
Reported Metabolites, References | |||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|