LBF18403SC03
| IDs and Links | |
|---|---|
| LipidBank | DFA0208 |
| LipidMaps | LMFA01030169 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18403SC03 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 6, 9, 12, 15-Octadecatetraenoic acid | |
| Formula | C18H28O2 |
| Exact Mass | 276.20893014 |
| Average Mass | 276.41372 |
| SMILES | CCC=CCC=CCC=CCC=CCCCCC(O)=O |
| Physicochemical Information | |
| -57.4 to -56.6°C | |
| 14888 at 16°C | |
| soluble in carbon disulfide and methyl alcohol.<<0269>><<0350>> | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
