| 5-Hydroperoxy-6,8,11,14-Eicosatetraenoic Acid/5-Hydroperoxy-6,8,11,14-Eicosatetraenoate
|
|
| Structural Information
|
|
|
5-Hydroperoxy-6,8,11,14-Eicosatetraenoic Acid/5-Hydroperoxy-6,8,11,14-Eicosatetraenoate
|
|
|
- 5-Hydroperoxy-6,8,11,14-Eicosatetraenoic Acid/5-Hydroperoxy-6,8,11,14-Eicosatetraenoate
|
|
|
|
| Formula
|
C20H32O4
|
| Exact Mass
|
336.23005951199997
|
| Average Mass
|
336.46567999999996
|
| SMILES
|
C(CC=CCC=CCC=CC=CC(OO)CCCC(O)=O)CCC
|
| Physicochemical Information
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Spectral Information
|
| Mass Spectra
|
GC-EI-MS(Me-ester; after reduction and TMS)
TeraoJet al.
TeraoJet al.
BorgeatPet al.
RabinovitchHet al.
KoshiharaYet al.
OchiKet al.
FurukawaMet al.GC-EI-MS(Me-ester; after reduction and TBDMS)(114), GC-EI-MS(Me-ester; after reduction, hydrogenation and TMS)
TeraoJet al.
TeraoJet al.
Porter_NA et al.
Porter_NA et al.
BorgeatPet al.
RabinovitchHet al.
MayerBet al.
|
| UV Spectra
|
UV
Porter_NA et al.conjugated diene: lmax=235nm, UV(Me-ester)
TeraoJet al. conjugated diene: lmax=232.5nm, UV(Me-ester; after reduction)
Porter_NA et al.
BorgeatPet al. conjugated trans, cis diene: lmax=235-236nm, conjugated trans, trans diene: lm
|
| IR Spectra
|
IR(Me-ester; after reduction)
Porter_NA et al.conjugated trans, cis diene: 985, 950cm-1, conjugated trans, trans diene: 989cm-1
|
| NMR Spectra
|
|
| Other Spectra
|
|
| Chromatograms
|
|