LBF22503SC01
| IDs and Links | |
|---|---|
| LipidBank | DFA0222 |
| LipidMaps | LMFA01030183 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF22503SC01 |
| Clupanodonic acid | |
|---|---|
| |
| Structural Information | |
| 4, 8, 12, 15, 19-Docosapentaenoic acid | |
| |
| Formula | C22H34O2 |
| Exact Mass | 330.255880332 |
| Average Mass | 330.50416000000007 |
| SMILES | C(CCC(O)=O)=CCCC=CCCC=CCC=CCCC=CCC |
| Physicochemical Information | |
| -78 °C | |
| 207 to 212 at 2 mmHg | |
| 0.9356 at 20 °C | |
| 1.5014 at 20 °C | |
| soluble in acetone, ether and petroleum ether.<<0470>><<0501>><<0502>><<0505>> | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
