LBF24603SC01
| IDs and Links | |
|---|---|
| LipidBank | DFA0225 |
| LipidMaps | LMFA01030186 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF24603SC01 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 4, 8, 12, 15, 19, 21-Tetracosahexaenoic acid | |
| Formula | C24H36O2 |
| Exact Mass | 356.271530396 |
| Average Mass | 356.54144 |
| SMILES | C(C=CCCC(O)=O)CC=CCCC=CCC=CCC=CCC=CCC |
| Physicochemical Information | |
| 0.9452 at 20 °C | |
| 1.5122 at 20 °C | |
| soluble in benzene, chloroform, methyl alcohol, ether and petroleum ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
