LBF24603SC01
IDs and Links | |
---|---|
LipidBank | DFA0225 |
LipidMaps | LMFA01030186 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | {{{KNApSAcK}}} |
mol | LBF24603SC01 |
4, 8, 12, 15, 19, 21-Tetracosahexaenoic acid | |
---|---|
![]() | |
Structural Information | |
4, 8, 12, 15, 19, 21-Tetracosahexaenoic acid | |
| |
Formula | C24H36O2 |
Exact Mass | 356.271530396 |
Average Mass | 356.54144 |
SMILES | C(C=CCCC(O)=O)CC=CCCC=CCC=CCC=CCC=CCC |
Physicochemical Information | |
0.9452 at 20 °C | |
1.5122 at 20 °C | |
soluble in benzene, chloroform, methyl alcohol, ether and petroleum ether. | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Other Spectra | |
Chromatograms |