LBF16403SC01
| IDs and Links | |
|---|---|
| LipidBank | DFA0202 |
| LipidMaps | LMFA01030163 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16403SC01 |
| 4, 7, 10, 13-Hexadesatetraenoic acid | |
|---|---|
| |
| Structural Information | |
| 4, 7, 10, 13-Hexadesatetraenoic acid | |
| |
| Formula | C16H24O2 |
| Exact Mass | 248.17763001199998 |
| Average Mass | 248.36056 |
| SMILES | CCC=CCC=CCC=CCC=CCCC(O)=O |
| Physicochemical Information | |
| soluble in acetone, alcohol, ether and petroleum ether. Silk_MH et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
