LBF18206SC05
IDs and Links | |
---|---|
LipidBank | DFA0159 |
LipidMaps | LMFA01030120 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | {{{KNApSAcK}}} |
mol | LBF18206SC05 |
Linoleic acid | |
---|---|
Structural Information | |
cis-9, cis-12-Octadecadienoic acid | |
| |
Formula | C18H32O2 |
Exact Mass | 280.240230268 |
Average Mass | 280.44548000000003 |
SMILES | CCCCCC=CCC=CCCCCCCCC(O)=O |
Physicochemical Information | |
-5°C | |
229°C to 230°C at 16mmHg | |
dX420 0.9031 | |
1.4711 at 20°C | |
soluble in acetone, alcohol, ether and petroleum ether. Matthews_NL et al. NicolaidesNet al. | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Other Spectra | |
Chromatograms | Gas liquid chromatogram (provided by Dr. Akiko Horiuchi). |
Reported Metabolites, References | |||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|