LBF18207HP02
| IDs and Links | |
|---|---|
| LipidBank | DFA8049 |
| LipidMaps | LMFA01040037 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18207HP02 |
| Methyl 13-Butylperoxy-9,11-Octadecadienoate | |
|---|---|
| |
| Structural Information | |
| Methyl 13-Butylperoxy-9,11-Octadecadienoate | |
| |
| Formula | C23H42O4 |
| Exact Mass | 382.30830983199996 |
| Average Mass | 382.57718 |
| SMILES | C(C)CCCC(OOC(C)(C)C)C=CC=CCCCCCCCC(=O)OC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(hydrogenation with palladium-charcoal) SchieberlePet al. |
| UV Spectra | lether/max=234nm SchieberlePet al. |
| IR Spectra | Ester carbonyl(1740cm-1), trans, trans diene(991cm-1) SchieberlePet al. |
| NMR Spectra | 1H-NMR SchieberlePet al.: C9-C12(5.5-6.1ppm), C13(4.1ppm), C8(2.1ppm) |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
