LBF18302HP03
IDs and Links | |
---|---|
LipidBank | DFA8066 |
LipidMaps | LMFA01040050 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | {{{KNApSAcK}}} |
mol | LBF18302HP03 |
GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
---|---|
![]() | |
Structural Information | |
Methyl-9,15-Dihydroperoxy-10,12,16-Octadecatrienoate | |
Formula | C19H32O6 |
Exact Mass | 356.219888756 |
Average Mass | 356.45378 |
SMILES | CC=CC(OO)CC=CC=CC(OO)CCCCCCCC(=O)OC |
Physicochemical Information | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after reduction and TMS-derivatization)<<8084>>: m/e=157[(CH2)7COOCH3] 143[SMTO=CHCH=CHCH3] |
UV Spectra | Conjugated diene: lmax=237nm<<8084>> |
IR Spectra | OOH group: 3700-3140cm-1[bonded], 3520-3510cm-1[free]; conjugated trans, cis diene: 985-979cm-1, 953-935cm-1; isolated trans unsaturation: 968-960cm-1<<8084>> |
NMR Spectra | 1H-NMR<<8084>>: C2: 2.31ppm; C8, 14: 1.75-1.85ppm; C9, 15: 4.40ppm; C10, 11, 12, 13, 16, 17: 5.25-6.90ppm; C18: 1.8ppm; OOH: 7.83-7.88ppm<<8084>> |
Other Spectra | |
Chromatograms |
[hide]Reported Metabolites, References | |||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|