LBF20403SC01
| IDs and Links | |
|---|---|
| LipidBank | DFA0215 |
| LipidMaps | LMFA01030176 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20403SC01 |
| 8, 11, 14, 17-Eicosatetraenoic acid / 8, 11, 14, 17-icosatetraenoic acid | |
|---|---|
| |
| Structural Information | |
| 8, 11, 14, 17-Eicosatetraenoic acid / 8, 11, 14, 17-icosatetraenoic acid | |
| |
| Formula | C20H32O2 |
| Exact Mass | 304.240230268 |
| Average Mass | 304.46688 |
| SMILES | C(CC=CCC=CCC=CCCCCCCC(O)=O)=CCC |
| Physicochemical Information | |
| soluble in acetone, methyl alcohol and petroleum ether. StoffelWet al. StoffelWet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
