LBF20406AM33
IDs and Links | |
---|---|
LipidBank | XPR7050 |
LipidMaps | LMFA08020036 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | {{{KNApSAcK}}} |
mol | LBF20406AM33 |
GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
---|---|
![]() | |
Structural Information | |
N-isopropyl α,α-dimethylarachidonoyl amide | |
Formula | C25H43NO |
Exact Mass | 373.334465003 |
Average Mass | 373.61505999999997 |
SMILES | C(=CCC=CCC=CCC=CCCCCC)CCC(C)(C)C(NC(C)C)=O |
Physicochemical Information | |
colorless oil <<7001>> | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.20-5.50 (m, 9H), 4.04-4.14 (m, lH), 2.76-2.90 (m, 6H), 1.90-2.15 (m, 4H), 1.10-1.60 (series of m, 20H), 0.90 (t, J=6.9Hz, 3H). <<7001>> |
Other Spectra | |
Chromatograms |
[hide]Reported Metabolites, References | ||||||||||
---|---|---|---|---|---|---|---|---|---|---|
|