LBF22109SC01
| IDs and Links | |
|---|---|
| LipidBank | DFA0128 |
| LipidMaps | LMFA01030089 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF22109SC01 |
| cis-Erucic acid | |
|---|---|
| |
| Structural Information | |
| cis-13-Docosenoic acid | |
| |
| Formula | C23H44O2 |
| Exact Mass | 352.334130652 |
| Average Mass | 352.59426 |
| SMILES | C(CCC(O)=O)CCCCCCCCC=CCCCCCCCCC |
| Physicochemical Information | |
| 34.7°C | |
| 281°C at 30 mmHg | |
| dX470 0.85321 | |
| 1.44438 at 70°C | |
| very soluble in ether and methylalchol <<0091>> <<0151>> <<0172>> <<0235>> <<0337>> | |
| Spectral Information | |
| Mass Spectra | File:DFA0128SP0001.gif (provided by Dr. Takeshi Kasama). |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | Gas liquid chromatogram File:DFA0128CH0001.gif (provided by Dr. Akiko Horiuchi). |
