LBF22406SC01
| IDs and Links | |
|---|---|
| LipidBank | DFA0217 |
| LipidMaps | LMFA01030178 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF22406SC01 |
| 7, 10, 13, 16-Docosatetraenoic acid | |
|---|---|
| |
| Structural Information | |
| 7, 10, 13, 16-Docosatetraenoic acid | |
| |
| Formula | C22H36O2 |
| Exact Mass | 332.271530396 |
| Average Mass | 332.52004000000005 |
| SMILES | C(CCC(O)=O)CCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| soluble in carbon disulfide, heptane and methyl alcohol. KlenkEet al. KlenkEet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
