LBF22409SC01
IDs and Links | |
---|---|
LipidBank | DFA0216 |
LipidMaps | LMFA01030177 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | {{{KNApSAcK}}} |
mol | LBF22409SC01 |
4, 7, 10, 13-Docosatetraenoic acid | |
---|---|
![]() | |
Structural Information | |
4, 7, 10, 13-Docosatetraenoic acid | |
| |
Formula | C22H36O2 |
Exact Mass | 332.271530396 |
Average Mass | 332.52004000000005 |
SMILES | C(CCC(O)=O)=CCC=CCC=CCC=CCCCCCCCC |
Physicochemical Information | |
soluble in acetone, methyl alcohol and petroleum ether. KlenkEet al. KlenkEet al. | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Other Spectra | |
Chromatograms |
Reported Metabolites, References | |||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|