LBF24109SC01
IDs and Links | |
---|---|
LipidBank | DFA0131 |
LipidMaps | LMFA01030092 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | {{{KNApSAcK}}} |
mol | LBF24109SC01 |
Nervonic acid | |
---|---|
Structural Information | |
cis-15-Tetracosenoic acid | |
| |
Formula | C24H46O2 |
Exact Mass | 366.349780716 |
Average Mass | 366.62084 |
SMILES | C(CCCCC(O)=O)CCCCCCCCC=CCCCCCCCC |
Physicochemical Information | |
42.5-43°C | |
soluble in acetone, ethanol and ether <<0092>> <<0210>> <<0290>> <<0503>> <<0504>> <<0506>> | |
Spectral Information | |
Mass Spectra | File:DFA0131SP0001.gif (provided by Dr. Takeshi Kasama). |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Other Spectra | |
Chromatograms | Gas liquid chromatogram File:DFA0131CH0001.gif File:DFA0131CH0002.gif (provided by Dr. Akiko Horiuchi). |
Reported Metabolites, References | ||||||||||
---|---|---|---|---|---|---|---|---|---|---|
|