LBF20207PG26: Difference between revisions
No edit summary |
m LBF20307PG10 moved to LBF20207PG26 |
||
(No difference)
| |||
Revision as of 17:51, 16 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1511 |
| LipidMaps | LMFA03010026 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20207PG26 |
| 15-KETOPROSTAGLANDIN F2α | |
|---|---|
| |
| Structural Information | |
| 7- [ 3 (R) ,5 (S) -Dihydroxy-2 (R) - (3-oxo-1 (E) -octenyl) cyclopentan-1 (R) -yl ] -5 (Z) -heptenoic acid | |
| |
| Formula | C20H32O5 |
| Exact Mass | 352.224974134 |
| Average Mass | 352.46508 |
| SMILES | C(CCC(=O)C=C[C@H]([C@H]1CC=CCCCC(O)=O)[C@@H](C[C@@H]1O)O)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
