LBF20207PG43: Difference between revisions
m LBF20307PG29 moved to LBF20207PG43 |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=- | |LipidMaps=- | ||
|SysName=9-oxo-11a,15S-dihydroxy- (8b) -prosta-5Z,13E-dien-1-oic acid | |SysName=9-oxo-11a,15S-dihydroxy- (8b) -prosta-5Z,13E-dien-1-oic acid | ||
|Common Name=&&8-iso Prostaglandin | |Common Name=&&8-iso Prostaglandin E_2&& | ||
}} | }} | ||
Revision as of 16:34, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1780 |
| LipidMaps | - |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20207PG43 |
| 8-iso Prostaglandin E2 | |
|---|---|
| |
| Structural Information | |
| 9-oxo-11a,15S-dihydroxy- (8b) -prosta-5Z,13E-dien-1-oic acid | |
| |
| Formula | C20H32O5 |
| Exact Mass | 352.224974134 |
| Average Mass | 352.46508 |
| SMILES | C(CC[C@H](O)C=C[C@H]([C@@H]1CC=CCCCC(O)=O)[C@@H](CC1=O)O)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
